About 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine
4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine (PubChem CID 138685862) has the molecular formula C10H13N5
and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine.
Molecular Properties
| Compound Name | 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine |
| PubChem CID | 138685862 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine |
| SMILES | CCCC(c1ccncn1)n1cncn1 |
| InChI | InChI=1S/C10H13N5/c1-2-3-10(15-8-12-7-14-15)9-4-5-11-6-13-9/h4-8,10H,2-3H2,1H3 |
| InChIKey | PVWZBAYGDHHYKH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine?
The IUPAC name of 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine (CID 138685862) is 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine.
What is the SMILES notation for 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine?
The canonical SMILES for 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine is CCCC(c1ccncn1)n1cncn1.
What is the InChIKey of 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine?
The InChIKey is PVWZBAYGDHHYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5/c1-2-3-10(15-8-12-7-14-15)9-4-5-11-6-13-9/h4-8,10H,2-3H2,1H3.
What are the key properties of 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine?
4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine has a molecular weight of 203.25 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,2,4-triazol-1-yl)butyl]pyrimidine is sourced from PubChem (CID 138685862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).