C24H29N7 — CID 138686353
6-[5-(4,7-diazaspiro[2.5]octan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 138686353) has the molecular formula C24H29N7 and a molecular weight of 415.55 g/mol. Its IUPAC name is 6-[5-(4,7-diazaspiro[2.5]octan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-[5-(4,7-diazaspiro[2.5]octan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 138686353 |
| Molecular Formula | C24H29N7 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 6-[5-(4,7-diazaspiro[2.5]octan-4-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1c(-c2[nH]c3ccc(N4CCNCC45CC5)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C24H29N7/c1-14(2)20-21(17-11-31-23(26-13-27-31)16(4)15(17)3)28-18-5-6-19(29-22(18)20)30-10-9-25-12-24(30)7-8-24/h5-6,11,13-14,25,28H,7-10,12H2,1-4H3 |
| InChIKey | NASYELSLIXXPMS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |