C30H40N6O2S — CID 138686396
4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-[(1,1-dioxothian-2-yl)methyl]cyclohexan-1-amine (PubChem CID 138686396) has the molecular formula C30H40N6O2S and a molecular weight of 548.76 g/mol. Its IUPAC name is 4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-[(1,1-dioxothian-2-yl)methyl]cyclohexan-1-amine.
| Compound Name | 4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-[(1,1-dioxothian-2-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 138686396 |
| Molecular Formula | C30H40N6O2S |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-[(1,1-dioxothian-2-yl)methyl]cyclohexan-1-amine |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(NCC5CCCCS5(=O)=O)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C30H40N6O2S/c1-18(2)27-28(24-16-36-30(32-17-33-36)20(4)19(24)3)35-26-13-12-25(34-29(26)27)21-8-10-22(11-9-21)31-15-23-7-5-6-14-39(23,37)38/h12-13,16-18,21-23,31,35H,5-11,14-15H2,1-4H3 |
| InChIKey | WVJZOFKSAHSNGJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |