C26H32F2N6O — CID 138686403
N-(2,2-difluoroethyl)-4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-methyl-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexan-1-amine (PubChem CID 138686403) has the molecular formula C26H32F2N6O and a molecular weight of 482.58 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-methyl-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-methyl-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 138686403 |
| Molecular Formula | C26H32F2N6O |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-[2-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-6-methyl-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexan-1-amine |
| SMILES | COc1cc(-c2[nH]c3cc(C)c(C4CCC(NCC(F)F)CC4)nc3c2C(C)C)cn2ncnc12 |
| InChI | InChI=1S/C26H32F2N6O/c1-14(2)22-24(17-10-20(35-4)26-30-13-31-34(26)12-17)32-19-9-15(3)23(33-25(19)22)16-5-7-18(8-6-16)29-11-21(27)28/h9-10,12-14,16,18,21,29,32H,5-8,11H2,1-4H3 |
| InChIKey | XCAKZJMZKINUAY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |