C25H30F3N7O — CID 138686560
8-methoxy-6-[3-propan-2-yl-5-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 138686560) has the molecular formula C25H30F3N7O and a molecular weight of 501.56 g/mol. Its IUPAC name is 8-methoxy-6-[3-propan-2-yl-5-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-methoxy-6-[3-propan-2-yl-5-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 138686560 |
| Molecular Formula | C25H30F3N7O |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 8-methoxy-6-[3-propan-2-yl-5-[4-(4,4,4-trifluorobutyl)piperazin-1-yl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(-c2[nH]c3ccc(N4CCN(CCCC(F)(F)F)CC4)nc3c2C(C)C)cn2ncnc12 |
| InChI | InChI=1S/C25H30F3N7O/c1-16(2)21-22(17-13-19(36-3)24-29-15-30-35(24)14-17)31-18-5-6-20(32-23(18)21)34-11-9-33(10-12-34)8-4-7-25(26,27)28/h5-6,13-16,31H,4,7-12H2,1-3H3 |
| InChIKey | LITUXMSMRZUNGK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |