C28H36N6O2S — CID 138686567
N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothiolan-3-amine (PubChem CID 138686567) has the molecular formula C28H36N6O2S and a molecular weight of 520.70 g/mol. Its IUPAC name is N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 138686567 |
| Molecular Formula | C28H36N6O2S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothiolan-3-amine |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(NC5CCS(=O)(=O)C5)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C28H36N6O2S/c1-16(2)25-26(22-13-34-28(29-15-30-34)18(4)17(22)3)33-24-10-9-23(32-27(24)25)19-5-7-20(8-6-19)31-21-11-12-37(35,36)14-21/h9-10,13,15-16,19-21,31,33H,5-8,11-12,14H2,1-4H3 |
| InChIKey | GYEMKEADSPMZIN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |