C28H36N6O2S — CID 138686611
4-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 138686611) has the molecular formula C28H36N6O2S and a molecular weight of 520.70 g/mol. Its IUPAC name is 4-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 138686611 |
| Molecular Formula | C28H36N6O2S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 4-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(N5CCS(=O)(=O)CC5)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C28H36N6O2S/c1-17(2)25-26(22-15-34-28(29-16-30-34)19(4)18(22)3)32-24-10-9-23(31-27(24)25)20-5-7-21(8-6-20)33-11-13-37(35,36)14-12-33/h9-10,15-17,20-21,32H,5-8,11-14H2,1-4H3 |
| InChIKey | QUOUHOVGOUVQBE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |