C29H38N6O2S — CID 138686696
N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothian-4-amine (PubChem CID 138686696) has the molecular formula C29H38N6O2S and a molecular weight of 534.73 g/mol. Its IUPAC name is N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 138686696 |
| Molecular Formula | C29H38N6O2S |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | N-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexyl]-1,1-dioxothian-4-amine |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(NC5CCS(=O)(=O)CC5)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C29H38N6O2S/c1-17(2)26-27(23-15-35-29(30-16-31-35)19(4)18(23)3)34-25-10-9-24(33-28(25)26)20-5-7-21(8-6-20)32-22-11-13-38(36,37)14-12-22/h9-10,15-17,20-22,32,34H,5-8,11-14H2,1-4H3 |
| InChIKey | GENIBPUHSKEPDL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |