C31H39N13 — CID 138686806
1-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N,N-bis[(1-methyltriazol-4-yl)methyl]piperidin-4-amine (PubChem CID 138686806) has the molecular formula C31H39N13 and a molecular weight of 593.74 g/mol. Its IUPAC name is 1-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N,N-bis[(1-methyltriazol-4-yl)methyl]piperidin-4-amine.
| Compound Name | 1-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N,N-bis[(1-methyltriazol-4-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 138686806 |
| Molecular Formula | C31H39N13 |
| Molecular Weight | 593.74 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | 1-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N,N-bis[(1-methyltriazol-4-yl)methyl]piperidin-4-amine |
| SMILES | Cc1c(-c2[nH]c3ccc(N4CCC(N(Cc5cn(C)nn5)Cc5cn(C)nn5)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C31H39N13/c1-19(2)28-29(25-17-44-31(32-18-33-44)21(4)20(25)3)34-26-7-8-27(35-30(26)28)42-11-9-24(10-12-42)43(15-22-13-40(5)38-36-22)16-23-14-41(6)39-37-23/h7-8,13-14,17-19,24,34H,9-12,15-16H2,1-6H3 |
| InChIKey | VUYSKIRXHOEFOP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |