C26H31F3N6O — CID 138686828
[6-[3-propan-2-yl-5-[4-(3,3,3-trifluoropropylamino)cyclohexyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol (PubChem CID 138686828) has the molecular formula C26H31F3N6O and a molecular weight of 500.57 g/mol. Its IUPAC name is [6-[3-propan-2-yl-5-[4-(3,3,3-trifluoropropylamino)cyclohexyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol.
| Compound Name | [6-[3-propan-2-yl-5-[4-(3,3,3-trifluoropropylamino)cyclohexyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol |
|---|---|
| PubChem CID | 138686828 |
| Molecular Formula | C26H31F3N6O |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | [6-[3-propan-2-yl-5-[4-(3,3,3-trifluoropropylamino)cyclohexyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]methanol |
| SMILES | CC(C)c1c(-c2cc(CO)c3ncnn3c2)[nH]c2ccc(C3CCC(NCCC(F)(F)F)CC3)nc12 |
| InChI | InChI=1S/C26H31F3N6O/c1-15(2)22-23(17-11-18(13-36)25-31-14-32-35(25)12-17)34-21-8-7-20(33-24(21)22)16-3-5-19(6-4-16)30-10-9-26(27,28)29/h7-8,11-12,14-16,19,30,34,36H,3-6,9-10,13H2,1-2H3 |
| InChIKey | ZZKMXFVCYRXQNR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |