C27H33F3N6 — CID 138686987
4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine (PubChem CID 138686987) has the molecular formula C27H33F3N6 and a molecular weight of 498.60 g/mol. Its IUPAC name is 4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine.
| Compound Name | 4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 138686987 |
| Molecular Formula | C27H33F3N6 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine |
| SMILES | Cc1c(-c2[nH]c3ccc(C4CCC(NCCC(F)(F)F)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C27H33F3N6/c1-15(2)23-24(20-13-36-26(32-14-33-36)17(4)16(20)3)35-22-10-9-21(34-25(22)23)18-5-7-19(8-6-18)31-12-11-27(28,29)30/h9-10,13-15,18-19,31,35H,5-8,11-12H2,1-4H3 |
| InChIKey | FQKXFNWMLXUFAI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |