C28H36N8O2 — CID 138687068
1-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]piperazin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 138687068) has the molecular formula C28H36N8O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 1-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]piperazin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]piperazin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 138687068 |
| Molecular Formula | C28H36N8O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 1-[4-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]piperazin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | Cc1c(-c2[nH]c3ccc(N4CCN(C(=O)CN5CCOCC5)CC4)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C28H36N8O2/c1-18(2)25-26(21-15-36-28(29-17-30-36)20(4)19(21)3)31-22-5-6-23(32-27(22)25)34-7-9-35(10-8-34)24(37)16-33-11-13-38-14-12-33/h5-6,15,17-18,31H,7-14,16H2,1-4H3 |
| InChIKey | RYALFMUUACUBRJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |