C25H28N8 — CID 138687131
2-[(1R,4R)-5-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]acetonitrile (PubChem CID 138687131) has the molecular formula C25H28N8 and a molecular weight of 440.56 g/mol. Its IUPAC name is 2-[(1R,4R)-5-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]acetonitrile.
| Compound Name | 2-[(1R,4R)-5-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]acetonitrile |
|---|---|
| PubChem CID | 138687131 |
| Molecular Formula | C25H28N8 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-[(1R,4R)-5-[2-(7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]acetonitrile |
| SMILES | Cc1c(-c2[nH]c3ccc(N4C[C@H]5C[C@@H]4CN5CC#N)nc3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C25H28N8/c1-14(2)22-23(19-12-33-25(27-13-28-33)16(4)15(19)3)29-20-5-6-21(30-24(20)22)32-11-17-9-18(32)10-31(17)8-7-26/h5-6,12-14,17-18,29H,8-11H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | PZSINKKQONCMKR-QZTJIDSGSA-N |
| XLogP | 3.80 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|