About 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate
3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate (PubChem CID 138687177) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate |
| PubChem CID | 138687177 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC(C)(C)C)c1c(-c2ccccc2)ccc2cncn12 |
| InChI | InChI=1S/C21H22N2O4/c1-21(2,3)27-20(25)17(19(24)26-4)18-16(14-8-6-5-7-9-14)11-10-15-12-22-13-23(15)18/h5-13,17H,1-4H3 |
| InChIKey | DJUZXPJWNWVLFZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate (CID 138687177) is 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate is COC(=O)C(C(=O)OC(C)(C)C)c1c(-c2ccccc2)ccc2cncn12.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate?
The InChIKey is DJUZXPJWNWVLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-21(2,3)27-20(25)17(19(24)26-4)18-16(14-8-6-5-7-9-14)11-10-15-12-22-13-23(15)18/h5-13,17H,1-4H3.
What are the key properties of 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate?
3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate has a molecular weight of 366.42 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl 2-(6-phenylimidazo[1,5-a]pyridin-5-yl)propanedioate is sourced from PubChem (CID 138687177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).