About diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium
diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium (PubChem CID 138687375) has the molecular formula C9H19F3NO+
and a molecular weight of 214.25 g/mol. Its IUPAC name is diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium.
Molecular Properties
| Compound Name | diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium |
| PubChem CID | 138687375 |
| Molecular Formula | C9H19F3NO+ |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium |
| SMILES | CC[N+](C)(CC)C(C)OC(F)C(F)F |
| InChI | InChI=1S/C9H19F3NO/c1-5-13(4,6-2)7(3)14-9(12)8(10)11/h7-9H,5-6H2,1-4H3/q+1 |
| InChIKey | IIJFAOIGBXBHHG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium?
The IUPAC name of diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium (CID 138687375) is diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium.
What is the SMILES notation for diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium?
The canonical SMILES for diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium is CC[N+](C)(CC)C(C)OC(F)C(F)F.
What is the InChIKey of diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium?
The InChIKey is IIJFAOIGBXBHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3NO/c1-5-13(4,6-2)7(3)14-9(12)8(10)11/h7-9H,5-6H2,1-4H3/q+1.
What are the key properties of diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium?
diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium has a molecular weight of 214.25 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-methyl-[1-(1,2,2-trifluoroethoxy)ethyl]azanium is sourced from PubChem (CID 138687375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).