C13H20F8INO — CID 138687381
1-methyl-1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidin-1-ium iodide (PubChem CID 138687381) has the molecular formula C13H20F8INO and a molecular weight of 485.20 g/mol. Its IUPAC name is 1-methyl-1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidin-1-ium iodide.
| Compound Name | 1-methyl-1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidin-1-ium iodide |
|---|---|
| PubChem CID | 138687381 |
| Molecular Formula | C13H20F8INO |
| Molecular Weight | 485.20 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 1-methyl-1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidin-1-ium iodide |
| SMILES | CC(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)[N+]1(C)CCCCC1.[I-] |
| InChI | InChI=1S/C13H20F8NO.HI/c1-9(22(2)6-4-3-5-7-22)23-8-11(16,17)13(20,21)12(18,19)10(14)15;/h9-10H,3-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ONTOFRIXCBLVEZ-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|