C36H35ClN6O5 — CID 138687399
2-[[4-[[3-(1-benzofuran-5-yl)-2-methylphenyl]methoxy]-5-chloro-2-[(5-cyano-3-pyridinyl)methoxy]phenyl]methylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 138687399) has the molecular formula C36H35ClN6O5 and a molecular weight of 667.17 g/mol. Its IUPAC name is 2-[[4-[[3-(1-benzofuran-5-yl)-2-methylphenyl]methoxy]-5-chloro-2-[(5-cyano-3-pyridinyl)methoxy]phenyl]methylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[4-[[3-(1-benzofuran-5-yl)-2-methylphenyl]methoxy]-5-chloro-2-[(5-cyano-3-pyridinyl)methoxy]phenyl]methylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 138687399 |
| Molecular Formula | C36H35ClN6O5 |
| Molecular Weight | 667.17 g/mol |
| Exact Mass | 666.24 |
| IUPAC Name | 2-[[4-[[3-(1-benzofuran-5-yl)-2-methylphenyl]methoxy]-5-chloro-2-[(5-cyano-3-pyridinyl)methoxy]phenyl]methylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | Cc1c(COc2cc(OCc3cncc(C#N)c3)c(CNC(CCCN=C(N)N)C(=O)O)cc2Cl)cccc1-c1ccc2occc2c1 |
| InChI | InChI=1S/C36H35ClN6O5/c1-22-27(4-2-5-29(22)25-7-8-32-26(13-25)9-11-46-32)21-48-34-15-33(47-20-24-12-23(16-38)17-41-18-24)28(14-30(34)37)19-43-31(35(44)45)6-3-10-42-36(39)40/h2,4-5,7-9,11-15,17-18,31,43H,3,6,10,19-21H2,1H3,(H,44,45)(H4,39,40,42) |
| InChIKey | HDEITTXSTJRYCM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.17 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|