C17H18F4N2O3 — CID 138687745
6-fluoro-4-(3-methoxypiperidin-4-yl)quinoline;2,2,2-trifluoroacetic acid (PubChem CID 138687745) has the molecular formula C17H18F4N2O3 and a molecular weight of 374.33 g/mol. Its IUPAC name is 6-fluoro-4-(3-methoxypiperidin-4-yl)quinoline;2,2,2-trifluoroacetic acid.
| Compound Name | 6-fluoro-4-(3-methoxypiperidin-4-yl)quinoline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138687745 |
| Molecular Formula | C17H18F4N2O3 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 6-fluoro-4-(3-methoxypiperidin-4-yl)quinoline;2,2,2-trifluoroacetic acid |
| SMILES | COC1CNCCC1c1ccnc2ccc(F)cc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H17FN2O.C2HF3O2/c1-19-15-9-17-6-4-12(15)11-5-7-18-14-3-2-10(16)8-13(11)14;3-2(4,5)1(6)7/h2-3,5,7-8,12,15,17H,4,6,9H2,1H3;(H,6,7) |
| InChIKey | OBVIWALPQMYEJZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |