About 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline
4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline (PubChem CID 138687855) has the molecular formula C18H17F3N2
and a molecular weight of 318.34 g/mol. Its IUPAC name is 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline.
Molecular Properties
| Compound Name | 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline |
| PubChem CID | 138687855 |
| Molecular Formula | C18H17F3N2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline |
| SMILES | Cc1ncc(C2=NC(C)(C)C(F)(F)c3ccccc32)cc1CF |
| InChI | InChI=1S/C18H17F3N2/c1-11-12(9-19)8-13(10-22-11)16-14-6-4-5-7-15(14)18(20,21)17(2,3)23-16/h4-8,10H,9H2,1-3H3 |
| InChIKey | XDRJCJKSNKAWAV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline?
The IUPAC name of 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline (CID 138687855) is 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline.
What is the SMILES notation for 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline?
The canonical SMILES for 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline is Cc1ncc(C2=NC(C)(C)C(F)(F)c3ccccc32)cc1CF.
What is the InChIKey of 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline?
The InChIKey is XDRJCJKSNKAWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3N2/c1-11-12(9-19)8-13(10-22-11)16-14-6-4-5-7-15(14)18(20,21)17(2,3)23-16/h4-8,10H,9H2,1-3H3.
What are the key properties of 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline?
4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline has a molecular weight of 318.34 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1-[5-(fluoromethyl)-6-methyl-3-pyridinyl]-3,3-dimethylisoquinoline is sourced from PubChem (CID 138687855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).