C14H7F5N2O4 — CID 138688503
(4-fluorophenyl)methyl-(2,3,5,6-tetrafluoro-4-nitrophenyl)carbamic acid (PubChem CID 138688503) has the molecular formula C14H7F5N2O4 and a molecular weight of 362.21 g/mol. Its IUPAC name is (4-fluorophenyl)methyl-(2,3,5,6-tetrafluoro-4-nitrophenyl)carbamic acid.
| Compound Name | (4-fluorophenyl)methyl-(2,3,5,6-tetrafluoro-4-nitrophenyl)carbamic acid |
|---|---|
| PubChem CID | 138688503 |
| Molecular Formula | C14H7F5N2O4 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (4-fluorophenyl)methyl-(2,3,5,6-tetrafluoro-4-nitrophenyl)carbamic acid |
| SMILES | O=C(O)N(Cc1ccc(F)cc1)c1c(F)c(F)c([N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C14H7F5N2O4/c15-7-3-1-6(2-4-7)5-20(14(22)23)12-8(16)10(18)13(21(24)25)11(19)9(12)17/h1-4H,5H2,(H,22,23) |
| InChIKey | ZGLKEGASRXYQTR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|