C18H28N4O3 — CID 138688729
[(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid (PubChem CID 138688729) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is [(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid.
| Compound Name | [(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid |
|---|---|
| PubChem CID | 138688729 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid |
| SMILES | N[C@@H](CCCCNC(=O)O)c1nc(C23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C18H28N4O3/c19-14(3-1-2-4-20-17(23)24)15-21-16(22-25-15)18-8-11-5-12(9-18)7-13(6-11)10-18/h11-14,20H,1-10,19H2,(H,23,24)/t11?,12?,13?,14-,18?/m0/s1 |
| InChIKey | RYFCFARKHZULJV-RZYZSWTKSA-N |
| XLogP | 2.98 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|