About [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid
[5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid (PubChem CID 138688731) has the molecular formula C18H28N4O3
and a molecular weight of 348.45 g/mol. Its IUPAC name is [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid.
Molecular Properties
| Compound Name | [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid |
| PubChem CID | 138688731 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid |
| SMILES | NC(CCCCNC(=O)O)c1nc(C23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C18H28N4O3/c19-14(3-1-2-4-20-17(23)24)15-21-16(22-25-15)18-8-11-5-12(9-18)7-13(6-11)10-18/h11-14,20H,1-10,19H2,(H,23,24) |
| InChIKey | RYFCFARKHZULJV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid?
The IUPAC name of [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid (CID 138688731) is [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid.
What is the SMILES notation for [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid?
The canonical SMILES for [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid is NC(CCCCNC(=O)O)c1nc(C23CC4CC(CC(C4)C2)C3)no1.
What is the InChIKey of [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid?
The InChIKey is RYFCFARKHZULJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O3/c19-14(3-1-2-4-20-17(23)24)15-21-16(22-25-15)18-8-11-5-12(9-18)7-13(6-11)10-18/h11-14,20H,1-10,19H2,(H,23,24).
What are the key properties of [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid?
[5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid has a molecular weight of 348.45 g/mol, XLogP of 2.98, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamic acid is sourced from PubChem (CID 138688731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).