C20H30N4O5 — CID 138688735
[1-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-5-(carboxyamino)pentyl]carbamic acid (PubChem CID 138688735) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is [1-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-5-(carboxyamino)pentyl]carbamic acid.
| Compound Name | [1-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-5-(carboxyamino)pentyl]carbamic acid |
|---|---|
| PubChem CID | 138688735 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | [1-[3-(1-adamantylmethyl)-1,2,4-oxadiazol-5-yl]-5-(carboxyamino)pentyl]carbamic acid |
| SMILES | O=C(O)NCCCCC(NC(=O)O)c1nc(CC23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C20H30N4O5/c25-18(26)21-4-2-1-3-15(22-19(27)28)17-23-16(24-29-17)11-20-8-12-5-13(9-20)7-14(6-12)10-20/h12-15,21-22H,1-11H2,(H,25,26)(H,27,28) |
| InChIKey | WCONSLXHJKSVLJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|