About [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid
[(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid (PubChem CID 138688758) has the molecular formula C26H24N2O5
and a molecular weight of 444.49 g/mol. Its IUPAC name is [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid |
| PubChem CID | 138688758 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid |
| SMILES | O=C(O)N[C@@H](CCCCN1C(=O)c2ccccc2C1=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H24N2O5/c29-24-21-13-4-5-14-22(21)25(30)28(24)16-7-6-15-23(27-26(31)32)18-9-8-12-20(17-18)33-19-10-2-1-3-11-19/h1-5,8-14,17,23,27H,6-7,15-16H2,(H,31,32)/t23-/m0/s1 |
| InChIKey | ICKQRTOTZKZLDI-QHCPKHFHSA-N |
| XLogP | 5.25 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid?
The IUPAC name of [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid (CID 138688758) is [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid.
What is the SMILES notation for [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid?
The canonical SMILES for [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid is O=C(O)N[C@@H](CCCCN1C(=O)c2ccccc2C1=O)c1cccc(Oc2ccccc2)c1.
What is the InChIKey of [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid?
The InChIKey is ICKQRTOTZKZLDI-QHCPKHFHSA-N. The full InChI is InChI=1S/C26H24N2O5/c29-24-21-13-4-5-14-22(21)25(30)28(24)16-7-6-15-23(27-26(31)32)18-9-8-12-20(17-18)33-19-10-2-1-3-11-19/h1-5,8-14,17,23,27H,6-7,15-16H2,(H,31,32)/t23-/m0/s1.
What are the key properties of [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid?
[(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid has a molecular weight of 444.49 g/mol, XLogP of 5.25, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-5-(1,3-dioxoisoindol-2-yl)-1-(3-phenoxyphenyl)pentyl]carbamic acid is sourced from PubChem (CID 138688758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).