C23H34F6N4O5 — CID 138689168
[(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-azaniumylpentyl]-dimethylazanium;bis(2,2,2-trifluoroacetate) (PubChem CID 138689168) has the molecular formula C23H34F6N4O5 and a molecular weight of 560.54 g/mol. Its IUPAC name is [(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-azaniumylpentyl]-dimethylazanium;bis(2,2,2-trifluoroacetate).
| Compound Name | [(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-azaniumylpentyl]-dimethylazanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 138689168 |
| Molecular Formula | C23H34F6N4O5 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | [(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-azaniumylpentyl]-dimethylazanium;bis(2,2,2-trifluoroacetate) |
| SMILES | C[NH+](C)CCCC[C@H]([NH3+])c1nc(C23CC4CC(CC(C4)C2)C3)no1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H32N4O.2C2HF3O2/c1-23(2)6-4-3-5-16(20)17-21-18(22-24-17)19-10-13-7-14(11-19)9-15(8-13)12-19;2*3-2(4,5)1(6)7/h13-16H,3-12,20H2,1-2H3;2*(H,6,7)/t13?,14?,15?,16-,19?;;/m0../s1 |
| InChIKey | HTVABDMOIUQJKC-OHEAZXOVSA-N |
| XLogP | -0.27 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|