About 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine
2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine (PubChem CID 138689640) has the molecular formula C20H19ClN4O2
and a molecular weight of 382.85 g/mol. Its IUPAC name is 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine.
Molecular Properties
| Compound Name | 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine |
| PubChem CID | 138689640 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine |
| SMILES | COc1ccc(CNc2nc3ccccc3c3nc(CCl)cn23)c(OC)c1 |
| InChI | InChI=1S/C20H19ClN4O2/c1-26-15-8-7-13(18(9-15)27-2)11-22-20-24-17-6-4-3-5-16(17)19-23-14(10-21)12-25(19)20/h3-9,12H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | FYNDRWMJDUFXPJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine?
The IUPAC name of 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine (CID 138689640) is 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine.
What is the SMILES notation for 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine?
The canonical SMILES for 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine is COc1ccc(CNc2nc3ccccc3c3nc(CCl)cn23)c(OC)c1.
What is the InChIKey of 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine?
The InChIKey is FYNDRWMJDUFXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN4O2/c1-26-15-8-7-13(18(9-15)27-2)11-22-20-24-17-6-4-3-5-16(17)19-23-14(10-21)12-25(19)20/h3-9,12H,10-11H2,1-2H3,(H,22,24).
What are the key properties of 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine?
2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine has a molecular weight of 382.85 g/mol, XLogP of 4.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]imidazo[1,2-c]quinazolin-5-amine is sourced from PubChem (CID 138689640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).