C10H15F3N2O3 — CID 138689719
(2,2,2-trifluoroacetyl) 3-(3-aminoazetidin-1-yl)-2,2-dimethylpropanoate (PubChem CID 138689719) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(3-aminoazetidin-1-yl)-2,2-dimethylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(3-aminoazetidin-1-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138689719 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(3-aminoazetidin-1-yl)-2,2-dimethylpropanoate |
| SMILES | CC(C)(CN1CC(N)C1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O3/c1-9(2,5-15-3-6(14)4-15)7(16)18-8(17)10(11,12)13/h6H,3-5,14H2,1-2H3 |
| InChIKey | BCYOWAXHXRJIIT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|