C9H7F3N2O3S — CID 138689739
(2,2,2-trifluoroacetyl) 4-(azetidin-3-yl)-1,3-thiazole-2-carboxylate (PubChem CID 138689739) has the molecular formula C9H7F3N2O3S and a molecular weight of 280.23 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-(azetidin-3-yl)-1,3-thiazole-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-(azetidin-3-yl)-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 138689739 |
| Molecular Formula | C9H7F3N2O3S |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-(azetidin-3-yl)-1,3-thiazole-2-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1nc(C2CNC2)cs1 |
| InChI | InChI=1S/C9H7F3N2O3S/c10-9(11,12)8(16)17-7(15)6-14-5(3-18-6)4-1-13-2-4/h3-4,13H,1-2H2 |
| InChIKey | GHVRNDUYEIQZKJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|