C43H28N2O2S2 — CID 138690750
2-carbazol-9-yl-9,9-dimethyl-7-(3-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2(6),4,7,9,11(18),12,14,16-octaen-9-yl)thioxanthene 10,10-dioxide (PubChem CID 138690750) has the molecular formula C43H28N2O2S2 and a molecular weight of 668.84 g/mol. Its IUPAC name is 2-carbazol-9-yl-9,9-dimethyl-7-(3-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2(6),4,7,9,11(18),12,14,16-octaen-9-yl)thioxanthene 10,10-dioxide.
| Compound Name | 2-carbazol-9-yl-9,9-dimethyl-7-(3-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2(6),4,7,9,11(18),12,14,16-octaen-9-yl)thioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 138690750 |
| Molecular Formula | C43H28N2O2S2 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 2-carbazol-9-yl-9,9-dimethyl-7-(3-thia-1-azapentacyclo[9.6.1.02,6.07,18.012,17]octadeca-2(6),4,7,9,11(18),12,14,16-octaen-9-yl)thioxanthene 10,10-dioxide |
| SMILES | CC1(C)c2cc(-c3cc4c5ccccc5n5c6sccc6c(c3)c45)ccc2S(=O)(=O)c2ccc(-n3c4ccccc4c4ccccc43)cc21 |
| InChI | InChI=1S/C43H28N2O2S2/c1-43(2)34-23-25(26-21-32-30-11-5-8-14-38(30)45-41(32)33(22-26)31-19-20-48-42(31)45)15-17-39(34)49(46,47)40-18-16-27(24-35(40)43)44-36-12-6-3-9-28(36)29-10-4-7-13-37(29)44/h3-24H,1-2H3 |
| InChIKey | GJARGGWKCZILGI-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 43.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |