About 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid
6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 138691696) has the molecular formula C11H16F2O3S
and a molecular weight of 266.31 g/mol. Its IUPAC name is 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 138691696 |
| Molecular Formula | C11H16F2O3S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1=CC(C(C)F)(C(C)F)C(S(=O)(=O)O)C=C1 |
| InChI | InChI=1S/C11H16F2O3S/c1-7-4-5-10(17(14,15)16)11(6-7,8(2)12)9(3)13/h4-6,8-10H,1-3H3,(H,14,15,16) |
| InChIKey | MMMDYVGXVDNLIY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid (CID 138691696) is 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid is CC1=CC(C(C)F)(C(C)F)C(S(=O)(=O)O)C=C1.
What is the InChIKey of 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is MMMDYVGXVDNLIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2O3S/c1-7-4-5-10(17(14,15)16)11(6-7,8(2)12)9(3)13/h4-6,8-10H,1-3H3,(H,14,15,16).
What are the key properties of 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid?
6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 266.31 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-bis(1-fluoroethyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 138691696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).