About 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine
3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine (PubChem CID 138692813) has the molecular formula C20H23F2N3
and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine |
| PubChem CID | 138692813 |
| Molecular Formula | C20H23F2N3 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine |
| SMILES | CCN1N=C(c2cc(F)ccc2F)C[C@@]1(CCCN)c1ccccc1 |
| InChI | InChI=1S/C20H23F2N3/c1-2-25-20(11-6-12-23,15-7-4-3-5-8-15)14-19(24-25)17-13-16(21)9-10-18(17)22/h3-5,7-10,13H,2,6,11-12,14,23H2,1H3/t20-/m0/s1 |
| InChIKey | YERISRIWKOACFK-FQEVSTJZSA-N |
| XLogP | 4.03 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine?
The IUPAC name of 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine (CID 138692813) is 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine.
What is the SMILES notation for 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine?
The canonical SMILES for 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine is CCN1N=C(c2cc(F)ccc2F)C[C@@]1(CCCN)c1ccccc1.
What is the InChIKey of 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine?
The InChIKey is YERISRIWKOACFK-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H23F2N3/c1-2-25-20(11-6-12-23,15-7-4-3-5-8-15)14-19(24-25)17-13-16(21)9-10-18(17)22/h3-5,7-10,13H,2,6,11-12,14,23H2,1H3/t20-/m0/s1.
What are the key properties of 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine?
3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine has a molecular weight of 343.42 g/mol, XLogP of 4.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-5-(2,5-difluorophenyl)-2-ethyl-3-phenyl-4H-pyrazol-3-yl]propan-1-amine is sourced from PubChem (CID 138692813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).