C17H22N2O6 — CID 138692871
(2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethylpentanoate (PubChem CID 138692871) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethylpentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 138692871 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)-2,2,4,4-tetramethylpentanoate |
| SMILES | CC(C)(CN1C(=O)C=CC1=O)CC(C)(C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H22N2O6/c1-16(2,10-18-11(20)5-6-12(18)21)9-17(3,4)15(24)25-19-13(22)7-8-14(19)23/h5-6H,7-10H2,1-4H3 |
| InChIKey | MSNRRWBKAAKBRM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|