C18H18O3S — CID 138692874
(1S,2S,4S)-6-(3-phenylsulfanylphenyl)cyclohex-5-ene-1,2,4-triol (PubChem CID 138692874) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (1S,2S,4S)-6-(3-phenylsulfanylphenyl)cyclohex-5-ene-1,2,4-triol.
| Compound Name | (1S,2S,4S)-6-(3-phenylsulfanylphenyl)cyclohex-5-ene-1,2,4-triol |
|---|---|
| PubChem CID | 138692874 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (1S,2S,4S)-6-(3-phenylsulfanylphenyl)cyclohex-5-ene-1,2,4-triol |
| SMILES | O[C@@H]1C=C(c2cccc(Sc3ccccc3)c2)[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C18H18O3S/c19-13-10-16(18(21)17(20)11-13)12-5-4-8-15(9-12)22-14-6-2-1-3-7-14/h1-10,13,17-21H,11H2/t13-,17+,18+/m1/s1 |
| InChIKey | LSISQEIZPHAQPD-BVGQSLNGSA-N |
| XLogP | 2.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |