C34H44F3N3O7 — CID 138693333
ethyl 2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 138693333) has the molecular formula C34H44F3N3O7 and a molecular weight of 663.73 g/mol. Its IUPAC name is ethyl 2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | ethyl 2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 138693333 |
| Molecular Formula | C34H44F3N3O7 |
| Molecular Weight | 663.73 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | ethyl 2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CCOC(=O)COCCOCCOCCOCC(=O)Nc1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C34H44F3N3O7/c1-5-47-30(42)20-46-15-13-44-11-10-43-12-14-45-19-29(41)38-23-17-26(35)31(27(36)18-23)33-32-25(24-8-6-7-9-28(24)39-32)16-22(2)40(33)21-34(3,4)37/h6-9,17-18,22,33,39H,5,10-16,19-21H2,1-4H3,(H,38,41)/t22-,33-/m1/s1 |
| InChIKey | WAQUJDGOPQCTDZ-DHYKOVJISA-N |
| XLogP | 5.10 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.73 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|