C31H39F3N2O5 — CID 138693719
2-[3-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]propoxy]acetic acid (PubChem CID 138693719) has the molecular formula C31H39F3N2O5 and a molecular weight of 576.66 g/mol. Its IUPAC name is 2-[3-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]propoxy]acetic acid.
| Compound Name | 2-[3-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]propoxy]acetic acid |
|---|---|
| PubChem CID | 138693719 |
| Molecular Formula | C31H39F3N2O5 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 2-[3-[4-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]butoxy]propoxy]acetic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCCCOCCCOCC(=O)O)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C31H39F3N2O5/c1-20-15-23-22-9-4-5-10-26(22)35-29(23)30(36(20)19-31(2,3)34)28-24(32)16-21(17-25(28)33)41-14-7-6-11-39-12-8-13-40-18-27(37)38/h4-5,9-10,16-17,20,30,35H,6-8,11-15,18-19H2,1-3H3,(H,37,38)/t20-,30-/m1/s1 |
| InChIKey | CUJJVHYKLWTYRI-PRAQEBQASA-N |
| XLogP | 6.20 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|