C32H34F3N3O3 — CID 138693776
4-[6-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]-3-pyridinyl]butanoic acid (PubChem CID 138693776) has the molecular formula C32H34F3N3O3 and a molecular weight of 565.64 g/mol. Its IUPAC name is 4-[6-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]-3-pyridinyl]butanoic acid.
| Compound Name | 4-[6-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]-3-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 138693776 |
| Molecular Formula | C32H34F3N3O3 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 4-[6-[[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]methyl]-3-pyridinyl]butanoic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCc3ccc(CCCC(=O)O)cn3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C32H34F3N3O3/c1-19-13-24-23-8-4-5-9-27(23)37-30(24)31(38(19)18-32(2,3)35)29-25(33)14-22(15-26(29)34)41-17-21-12-11-20(16-36-21)7-6-10-28(39)40/h4-5,8-9,11-12,14-16,19,31,37H,6-7,10,13,17-18H2,1-3H3,(H,39,40)/t19-,31-/m1/s1 |
| InChIKey | OTUNINQMFUTKFD-FZYZMVIOSA-N |
| XLogP | 6.91 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|