C21H22F3N7O2 — CID 138693802
N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 138693802) has the molecular formula C21H22F3N7O2 and a molecular weight of 461.45 g/mol. Its IUPAC name is N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 138693802 |
| Molecular Formula | C21H22F3N7O2 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-propan-2-yl-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1cc(Nc2nc3c(C(C)C)ccc(OCC(F)(F)F)n3n2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C21H22F3N7O2/c1-12(2)15-6-8-18(33-10-21(22,23)24)31-19(15)27-20(29-31)26-14-5-7-16(17(9-14)32-4)30-11-25-13(3)28-30/h5-9,11-12H,10H2,1-4H3,(H,26,29) |
| InChIKey | GZKZJHIZNALCMC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |