C15H20F3N3O4S — CID 138693828
ethyl N-[[3-(2-hydroxypropan-2-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]carbamothioyl]carbamate (PubChem CID 138693828) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is ethyl N-[[3-(2-hydroxypropan-2-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[3-(2-hydroxypropan-2-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 138693828 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | ethyl N-[[3-(2-hydroxypropan-2-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1nc(OC(C)C(F)(F)F)ccc1C(C)(C)O |
| InChI | InChI=1S/C15H20F3N3O4S/c1-5-24-13(22)21-12(26)20-11-9(14(3,4)23)6-7-10(19-11)25-8(2)15(16,17)18/h6-8,23H,5H2,1-4H3,(H2,19,20,21,22,26) |
| InChIKey | VZSJOUXSOGYCBY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|