C35H45F3N4O3 — CID 138693836
2-[9-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,9-diazaspiro[5.5]undecan-3-yl]acetic acid (PubChem CID 138693836) has the molecular formula C35H45F3N4O3 and a molecular weight of 626.76 g/mol. Its IUPAC name is 2-[9-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,9-diazaspiro[5.5]undecan-3-yl]acetic acid.
| Compound Name | 2-[9-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,9-diazaspiro[5.5]undecan-3-yl]acetic acid |
|---|---|
| PubChem CID | 138693836 |
| Molecular Formula | C35H45F3N4O3 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | 2-[9-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl]-3,9-diazaspiro[5.5]undecan-3-yl]acetic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(OCCN3CCC4(CC3)CCN(CC(=O)O)CC4)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C35H45F3N4O3/c1-23-18-26-25-6-4-5-7-29(25)39-32(26)33(42(23)22-34(2,3)38)31-27(36)19-24(20-28(31)37)45-17-16-40-12-8-35(9-13-40)10-14-41(15-11-35)21-30(43)44/h4-7,19-20,23,33,39H,8-18,21-22H2,1-3H3,(H,43,44)/t23-,33-/m1/s1 |
| InChIKey | YZOSKYFWXUOQBX-PVAZPRTOSA-N |
| XLogP | 6.17 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|