C32H40F3N3O7 — CID 138693908
2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 138693908) has the molecular formula C32H40F3N3O7 and a molecular weight of 635.68 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 138693908 |
| Molecular Formula | C32H40F3N3O7 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | 2-[2-[2-[2-[2-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]anilino]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NC(=O)COCCOCCOCCOCC(=O)O)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C32H40F3N3O7/c1-20-14-23-22-6-4-5-7-26(22)37-30(23)31(38(20)19-32(2,3)35)29-24(33)15-21(16-25(29)34)36-27(39)17-44-12-10-42-8-9-43-11-13-45-18-28(40)41/h4-7,15-16,20,31,37H,8-14,17-19H2,1-3H3,(H,36,39)(H,40,41)/t20-,31-/m1/s1 |
| InChIKey | KVCXTDOKMXPSBJ-PLTNMMHCSA-N |
| XLogP | 4.62 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|