C28H26F3N9O6 — CID 138694355
methyl 4-[3-(azidomethyl)-4-[[2-[2-[(2-methylpropan-2-yl)oxycarbonyl-(2,2,2-trifluoroethyl)amino]-4-pyridinyl]-1,3-oxazole-4-carbonyl]amino]pyrazol-1-yl]benzoate (PubChem CID 138694355) has the molecular formula C28H26F3N9O6 and a molecular weight of 641.57 g/mol. Its IUPAC name is methyl 4-[3-(azidomethyl)-4-[[2-[2-[(2-methylpropan-2-yl)oxycarbonyl-(2,2,2-trifluoroethyl)amino]-4-pyridinyl]-1,3-oxazole-4-carbonyl]amino]pyrazol-1-yl]benzoate.
| Compound Name | methyl 4-[3-(azidomethyl)-4-[[2-[2-[(2-methylpropan-2-yl)oxycarbonyl-(2,2,2-trifluoroethyl)amino]-4-pyridinyl]-1,3-oxazole-4-carbonyl]amino]pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 138694355 |
| Molecular Formula | C28H26F3N9O6 |
| Molecular Weight | 641.57 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | methyl 4-[3-(azidomethyl)-4-[[2-[2-[(2-methylpropan-2-yl)oxycarbonyl-(2,2,2-trifluoroethyl)amino]-4-pyridinyl]-1,3-oxazole-4-carbonyl]amino]pyrazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2cc(NC(=O)c3coc(-c4ccnc(N(CC(F)(F)F)C(=O)OC(C)(C)C)c4)n3)c(CN=[N+]=[N-])n2)cc1 |
| InChI | InChI=1S/C28H26F3N9O6/c1-27(2,3)46-26(43)39(15-28(29,30)31)22-11-17(9-10-33-22)24-36-21(14-45-24)23(41)35-20-13-40(37-19(20)12-34-38-32)18-7-5-16(6-8-18)25(42)44-4/h5-11,13-14H,12,15H2,1-4H3,(H,35,41) |
| InChIKey | HXNJXKMBQAZIMP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 190.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|