C17H36N4O4 — CID 138694451
tert-butyl N-[2-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethoxy]ethyl]carbamate (PubChem CID 138694451) has the molecular formula C17H36N4O4 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 138694451 |
| Molecular Formula | C17H36N4O4 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | tert-butyl N-[2-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCN1CCN(CCOCCN)CC1 |
| InChI | InChI=1S/C17H36N4O4/c1-17(2,3)25-16(22)19-5-13-24-15-11-21-8-6-20(7-9-21)10-14-23-12-4-18/h4-15,18H2,1-3H3,(H,19,22) |
| InChIKey | VUNHMHLBTVMXOP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|