C35H39N3O4 — CID 138694901
1,2,2-tris(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethanol (PubChem CID 138694901) has the molecular formula C35H39N3O4 and a molecular weight of 565.71 g/mol. Its IUPAC name is 1,2,2-tris(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethanol.
| Compound Name | 1,2,2-tris(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethanol |
|---|---|
| PubChem CID | 138694901 |
| Molecular Formula | C35H39N3O4 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 1,2,2-tris(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethanol |
| SMILES | C=CCN1COc2ccc(C(O)C(c3ccc4c(c3)CN(CC=C)CO4)c3ccc4c(c3)CN(CC=C)CO4)cc2C1 |
| InChI | InChI=1S/C35H39N3O4/c1-4-13-36-19-28-16-25(7-10-31(28)40-22-36)34(26-8-11-32-29(17-26)20-37(14-5-2)23-41-32)35(39)27-9-12-33-30(18-27)21-38(15-6-3)24-42-33/h4-12,16-18,34-35,39H,1-3,13-15,19-24H2 |
| InChIKey | QMJNMOTZESMOMI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 57.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|