C25H34F2N4O6 — CID 138694903
tert-butyl N-[3-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]-2,2-difluoropropyl]-N-methylcarbamate (PubChem CID 138694903) has the molecular formula C25H34F2N4O6 and a molecular weight of 524.57 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]-2,2-difluoropropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]-2,2-difluoropropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138694903 |
| Molecular Formula | C25H34F2N4O6 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | tert-butyl N-[3-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]propoxy]-2,2-difluoropropyl]-N-methylcarbamate |
| SMILES | CN(CC(F)(F)COCCCc1cccc2c1n(C)c(=O)n2C1CCC(=O)NC1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34F2N4O6/c1-24(2,3)37-23(35)29(4)14-25(26,27)15-36-13-7-9-16-8-6-10-17-20(16)30(5)22(34)31(17)18-11-12-19(32)28-21(18)33/h6,8,10,18H,7,9,11-15H2,1-5H3,(H,28,32,33) |
| InChIKey | RXSJAPKVQCSGOX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|