C18H34N4O6 — CID 138695957
2-[2-[2-[2-[2-(4-aminopyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-tert-butylcarbamic acid (PubChem CID 138695957) has the molecular formula C18H34N4O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(4-aminopyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-tert-butylcarbamic acid.
| Compound Name | 2-[2-[2-[2-[2-(4-aminopyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 138695957 |
| Molecular Formula | C18H34N4O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 2-[2-[2-[2-[2-(4-aminopyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCOCCOCCOCCOCCn1cc(N)cn1)C(=O)O |
| InChI | InChI=1S/C18H34N4O6/c1-18(2,3)22(17(23)24)5-7-26-9-11-28-13-12-27-10-8-25-6-4-21-15-16(19)14-20-21/h14-15H,4-13,19H2,1-3H3,(H,23,24) |
| InChIKey | KDVQULWGDOTOMC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|