C24H27ClN6O6 — CID 138695980
2-[2-[2-[2-[4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]indol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 138695980) has the molecular formula C24H27ClN6O6 and a molecular weight of 530.97 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]indol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[2-[4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]indol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 138695980 |
| Molecular Formula | C24H27ClN6O6 |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 2-[2-[2-[2-[4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]indol-1-yl]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCOCCn1ccc2c(Nc3nc(Cl)cc4nc[nH]c(=O)c34)cccc21 |
| InChI | InChI=1S/C24H27ClN6O6/c25-20-14-18-21(23(32)28-15-27-18)22(30-20)29-17-2-1-3-19-16(17)4-6-31(19)7-9-36-11-13-37-12-10-35-8-5-26-24(33)34/h1-4,6,14-15,26H,5,7-13H2,(H,29,30)(H,33,34)(H,27,28,32) |
| InChIKey | GMQCVKYKTKPALU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 152.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|