About 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one
7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 138696308) has the molecular formula C19H24F2N4OS
and a molecular weight of 394.49 g/mol. Its IUPAC name is 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| PubChem CID | 138696308 |
| Molecular Formula | C19H24F2N4OS |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSC2CCNCC2)nc2cc(NC3CCCC3)c(F)c(F)c12 |
| InChI | InChI=1S/C19H24F2N4OS/c20-17-14(23-11-3-1-2-4-11)9-13-16(18(17)21)19(26)25-15(24-13)10-27-12-5-7-22-8-6-12/h9,11-12,22-23H,1-8,10H2,(H,24,25,26) |
| InChIKey | ZZMXDEQKPDLFMW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one?
The IUPAC name of 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one (CID 138696308) is 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one.
What is the SMILES notation for 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one?
The canonical SMILES for 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one is O=c1[nH]c(CSC2CCNCC2)nc2cc(NC3CCCC3)c(F)c(F)c12.
What is the InChIKey of 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one?
The InChIKey is ZZMXDEQKPDLFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N4OS/c20-17-14(23-11-3-1-2-4-11)9-13-16(18(17)21)19(26)25-15(24-13)10-27-12-5-7-22-8-6-12/h9,11-12,22-23H,1-8,10H2,(H,24,25,26).
What are the key properties of 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one?
7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one has a molecular weight of 394.49 g/mol, XLogP of 3.54, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(cyclopentylamino)-5,6-difluoro-2-(piperidin-4-ylsulfanylmethyl)-3H-quinazolin-4-one is sourced from PubChem (CID 138696308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).