About 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole
5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole (PubChem CID 138696722) has the molecular formula C15H12FN5O4
and a molecular weight of 345.29 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole |
| PubChem CID | 138696722 |
| Molecular Formula | C15H12FN5O4 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole |
| SMILES | COc1ccc(-c2c(F)cc([N+](=O)[O-])cc2-c2nn[nH]n2)cc1OC |
| InChI | InChI=1S/C15H12FN5O4/c1-24-12-4-3-8(5-13(12)25-2)14-10(15-17-19-20-18-15)6-9(21(22)23)7-11(14)16/h3-7H,1-2H3,(H,17,18,19,20) |
| InChIKey | KTCBKYUNNYHPOO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole?
The IUPAC name of 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole (CID 138696722) is 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole.
What is the SMILES notation for 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole?
The canonical SMILES for 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole is COc1ccc(-c2c(F)cc([N+](=O)[O-])cc2-c2nn[nH]n2)cc1OC.
What is the InChIKey of 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole?
The InChIKey is KTCBKYUNNYHPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN5O4/c1-24-12-4-3-8(5-13(12)25-2)14-10(15-17-19-20-18-15)6-9(21(22)23)7-11(14)16/h3-7H,1-2H3,(H,17,18,19,20).
What are the key properties of 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole?
5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole has a molecular weight of 345.29 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,4-dimethoxyphenyl)-3-fluoro-5-nitrophenyl]-2H-tetrazole is sourced from PubChem (CID 138696722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).