C29H28FN3O4S — CID 138697487
2-butyl-3-[(1S)-2,3-dihydro-1H-inden-1-yl]-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxypyrimidin-4-one (PubChem CID 138697487) has the molecular formula C29H28FN3O4S and a molecular weight of 533.63 g/mol. Its IUPAC name is 2-butyl-3-[(1S)-2,3-dihydro-1H-inden-1-yl]-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxypyrimidin-4-one.
| Compound Name | 2-butyl-3-[(1S)-2,3-dihydro-1H-inden-1-yl]-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxypyrimidin-4-one |
|---|---|
| PubChem CID | 138697487 |
| Molecular Formula | C29H28FN3O4S |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-butyl-3-[(1S)-2,3-dihydro-1H-inden-1-yl]-5-[4-(6-fluoro-2-methyl-3-pyridinyl)phenyl]sulfonyl-6-hydroxypyrimidin-4-one |
| SMILES | CCCCc1nc(O)c(S(=O)(=O)c2ccc(-c3ccc(F)nc3C)cc2)c(=O)n1[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C29H28FN3O4S/c1-3-4-9-26-32-28(34)27(29(35)33(26)24-16-12-19-7-5-6-8-23(19)24)38(36,37)21-13-10-20(11-14-21)22-15-17-25(30)31-18(22)2/h5-8,10-11,13-15,17,24,34H,3-4,9,12,16H2,1-2H3/t24-/m0/s1 |
| InChIKey | XOQFZNCWRUWIBZ-DEOSSOPVSA-N |
| XLogP | 5.17 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|