C31H28F8N4 — CID 138698525
4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluoroaniline (PubChem CID 138698525) has the molecular formula C31H28F8N4 and a molecular weight of 608.58 g/mol. Its IUPAC name is 4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluoroaniline.
| Compound Name | 4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 138698525 |
| Molecular Formula | C31H28F8N4 |
| Molecular Weight | 608.58 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluoroaniline |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(N)cc1F)CN(Cc1ccc(C(F)(F)F)cc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C31H28F8N4/c1-3-17-6-5-7-18(4-2)28(17)43-29(21-13-25(33)26(40)14-24(21)32)22-16-42(11-10-27(22)41-43)15-19-8-9-20(30(34,35)36)12-23(19)31(37,38)39/h5-9,12-14H,3-4,10-11,15-16,40H2,1-2H3 |
| InChIKey | XXALXNFXUIBMBE-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.58 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|